Citric Acid
eMolecules 140-77-2 | 3-Cylcopentylpropanoic acid | Ambeed | MFCD00001392 | 142.198 | C8H14O2 | 98.000 | OC(=O)CCC1CCCC1 | 5g | 552737380
3-Cylcopentylpropanoic acid | Ambeed | 140-77-2 | MFCD00001392 | 142.198 | C8H14O2 | 98.000 | OC(=O)CCC1CCCC1 | 5g | 552737380
eMolecules 112-85-6 | Docosanoic acid | Ambeed | MFCD00002807 | 340.592 | C22H44O2 | 85.000 | CCCCCCCCCCCCCCCCCCCCCC(O)=O | 10g | 490564785
Docosanoic acid | Ambeed | 112-85-6 | MFCD00002807 | 340.592 | C22H44O2 | 85.000 | CCCCCCCCCCCCCCCCCCCCCC(O)=O | 10g | 490564785
eMolecules 2377643-37-1 | 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methylbenzoic acid | Synthonix248.238 | C12H12N2O4 | 98.000 | Cc1ccc(cc1N1CCC(=O)NC1=O)C(O)=O | 50mg | 784552857
3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methylbenzoic acid | Synthonix | 2377643-37-1248.238 | C12H12N2O4 | 98.000 | Cc1ccc(cc1N1CCC(=O)NC1=O)C(O)=O | 50mg | 784552857
eMolecules 147664-83-3 | Medchem Express | Citric acid-d4 | 5mg | 771359086 | HY-N1428S | MFCD00209702 | 196.147 | C6H8O7
Medchem Express | AZD4573 | 5mg | 446260119 | HY-112088 | 2057509-72-3 | 429.950 | C22H28ClN5O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Medchemexpress LLC HY-N1428 100mg Medchemexpress, Citric acid CAS:77-92-9 Purity:>98%
Medchemexpress, HY-N1428 100mg Citric acid CAS:77-92-9 Citric acid is a weak organic tricarboxylic acid found in citrus fruits. Citric acid is a natural preservative and food tartness enhancer. Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.
![eMolecules 170116-46-8 | (2S)-Azepane-1,2-dicarboxylic acid 1-benzyl ester | J&W PharmLab LLC277.320 | C15H19NO4 | 96.000 | OC(=O)[C@@H]1CCCCCN1C(=O)OCc1ccccc1 | 1g | 773120000](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502478758.JPG-250.jpg)
eMolecules 170116-46-8 | (2S)-Azepane-1,2-dicarboxylic acid 1-benzyl ester | J&W PharmLab LLC277.320 | C15H19NO4 | 96.000 | OC(=O)[C@@H]1CCCCCN1C(=O)OCc1ccccc1 | 1g | 773120000
(2S)-Azepane-1,2-dicarboxylic acid 1-benzyl ester | J&W PharmLab LLC | 170116-46-8277.320 | C15H19NO4 | 96.000 | OC(=O)[C@@H]1CCCCCN1C(=O)OCc1ccccc1 | 1g | 773120000
eMolecules 1570374-32-1 | Medchem Express | TAK1-IN-4 | 5mg | 779715093 | HY-122642 | 323.352 | C18H17N3O3
Ambeed | (S)-3-Isopropylmorpholine hydrochloride | 1g | 632810102 | A964330 | 218595-15-4 | MFCD22199184 | 165.660 | C7H16ClNO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 746630-77-3 | AstaTech | (2-PROPOXYPHENOXY)ACETIC ACID | 0.1g | 721428443 | E86977 | 95 | MFCD05270006 | 210.229 | C11H14O4
AstaTech | (2-PROPOXYPHENOXY)ACETIC ACID | 0.1g | 721428443 | E86977 | 95.000 | 746630-77-3 | MFCD05270006 | 210.229 | C11H14O4
![eMolecules 7132-93-6 | TRANS-(4-METHYL-CYCLOHEXYL)-ACETIC ACID | AstaTech | MFCD06796533 | 156.225 | C9H16O2 | 96.000 | C[C@H]1CC[C@H](CC(O)=O)CC1 | 0.1g | 771346207](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502473786.JPG-250.jpg)
eMolecules 7132-93-6 | TRANS-(4-METHYL-CYCLOHEXYL)-ACETIC ACID | AstaTech | MFCD06796533 | 156.225 | C9H16O2 | 96.000 | C[C@H]1CC[C@H](CC(O)=O)CC1 | 0.1g | 771346207
TRANS-(4-METHYL-CYCLOHEXYL)-ACETIC ACID | AstaTech | 7132-93-6 | MFCD06796533 | 156.225 | C9H16O2 | 96.000 | C[C@H]1CC[C@H](CC(O)=O)CC1 | 0.1g | 771346207
![eMolecules 2803119-03-9 | Acid-PEG5-Amide-Tri(3-methoxypropanamide-PEG4-Azide) Methane | Broadpharm1390.548 | C57H107N13O26 | 98.000 | OC(=O)CCOCCOCCOCCOCCOCCC(=O)NC(COCCC(=O)NCCOCCOCCOCCOCCN=[N+]=[N-])(COCCC(=O)NCCOCCOCCOCCOCCN=[N+]=[N-])COCCC(=O)NCCOCCOCCOCCOCCN=[N+]=[N-] | 50mg | 771351503](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502478816.JPG-250.jpg)
eMolecules 2803119-03-9 | Acid-PEG5-Amide-Tri(3-methoxypropanamide-PEG4-Azide) Methane | Broadpharm1390.548 | C57H107N13O26 | 98.000 | OC(=O)CCOCCOCCOCCOCCOCCC(=O)NC(COCCC(=O)NCCOCCOCCOCCOCCN=[N+]=[N-])(COCCC(=O)NCCOCCOCCOCCOCCN=[N+]=[N-])COCCC(=O)NCCOCCOCCOCCOCCN=[N+]=[N-] | 50mg | 771351503
Acid-PEG5-Amide-Tri(3-methoxypropanamide-PEG4-Azide) Methane | Broadpharm | 2803119-03-91390.548 | C57H107N13O26 | 98.000 | OC(=O)CCOCCOCCOCCOCCOCCC(=O)NC(COCCC(=O)NCCOCCOCCOCCOCCN=[N+]=[N-])(COCCC(=O)NCCOCCOCCOCCOCCN=[N+]=[N-])COCCC(=O)NCCOCCOCCOCCOCCN=[N+]=[N-] | 50mg | 771351503
![eMolecules 78078-92-9 | 2-OXO-1,2-DIHYDROBENZO[CD]INDOLE-6-SULFONYL CHLORIDE | AstaTech | MFCD02732837 | 267.680 | C11H6ClNO3S | 95.000 | ClS(=O)(=O)c1ccc2NC(=O)c3cccc1c23 | 0.25g | 718079920](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502470156.JPG-250.jpg)
eMolecules 78078-92-9 | 2-OXO-1,2-DIHYDROBENZO[CD]INDOLE-6-SULFONYL CHLORIDE | AstaTech | MFCD02732837 | 267.680 | C11H6ClNO3S | 95.000 | ClS(=O)(=O)c1ccc2NC(=O)c3cccc1c23 | 0.25g | 718079920
2-OXO-1,2-DIHYDROBENZO[CD]INDOLE-6-SULFONYL CHLORIDE | AstaTech | 78078-92-9 | MFCD02732837 | 267.680 | C11H6ClNO3S | 95.000 | ClS(=O)(=O)c1ccc2NC(=O)c3cccc1c23 | 0.25g | 718079920
eMolecules 2356045-01-5 | 4-tert-Butoxycarbonylamino-4-pyridin-2-yl-butyric acid | J&W PharmLab LLC280.324 | C14H20N2O4 | 96.000 | CC(C)(C)OC(=O)NC(CCC(O)=O)c1ccccn1 | 1g | 761737021
4-tert-Butoxycarbonylamino-4-pyridin-2-yl-butyric acid | J&W PharmLab LLC | 2356045-01-5280.324 | C14H20N2O4 | 96.000 | CC(C)(C)OC(=O)NC(CCC(O)=O)c1ccccn1 | 1g | 761737021
eMolecules 1567657-46-8 | Medchem Express | HIF-PHD-IN-1 | 5mg | 761953682 | HY-131346 | 419.22 | C17H12Cl2N6O3
Ambeed | trans-tert-Butyl 4-oxohexahydro-2H-pyrano[32-c]pyridine-6(7H)-carboxylate | 100mg | 687213315 | A843152 | 2177266-88-3 | 255.314 | C13H21NO4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 1038291-18-7 | 1-Difluoromethanesulfonylpiperidine-3-carboxylic acid | ChemScene | MFCD11156729 | 243.220 | C7H11F2NO4S | 98.000 | OC(=O)C1CCCN(C1)S(=O)(=O)C(F)F | 100mg | 680058614
1-Difluoromethanesulfonylpiperidine-3-carboxylic acid | ChemScene | 1038291-18-7 | MFCD11156729 | 243.220 | C7H11F2NO4S | 98.000 | OC(=O)C1CCCN(C1)S(=O)(=O)C(F)F | 100mg | 680058614
eMolecules 1402666-29-8 | 2-(4-Cyano-phenyl)-5-trifluoromethyl-2H-pyrazole-3-carboxylic acid | J&W PharmLab LLC281.194 | C12H6F3N3O2 | 96.000 | OC(=O)c1cc(nn1-c1ccc(cc1)C#N)C(F)(F)F | 50mg | 746318599
2-(4-Cyano-phenyl)-5-trifluoromethyl-2H-pyrazole-3-carboxylic acid | J&W PharmLab LLC | 1402666-29-8281.194 | C12H6F3N3O2 | 96.000 | OC(=O)c1cc(nn1-c1ccc(cc1)C#N)C(F)(F)F | 50mg | 746318599